4-(6-methylpyrazin-2-yl)oxybenzaldehyde structure
|
Common Name | 4-(6-methylpyrazin-2-yl)oxybenzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 906353-01-3 | Molecular Weight | 214.22000 | |
| Density | 1.228g/cm3 | Boiling Point | 356.5ºC at 760 mmHg | |
| Molecular Formula | C12H10N2O2 | Melting Point | 72-73ºC | |
| MSDS | N/A | Flash Point | 169.4ºC | |
| Name | 4-(6-methylpyrazin-2-yl)oxybenzaldehyde |
|---|
| Density | 1.228g/cm3 |
|---|---|
| Boiling Point | 356.5ºC at 760 mmHg |
| Melting Point | 72-73ºC |
| Molecular Formula | C12H10N2O2 |
| Molecular Weight | 214.22000 |
| Flash Point | 169.4ºC |
| Exact Mass | 214.07400 |
| PSA | 52.08000 |
| LogP | 2.38980 |
| Index of Refraction | 1.609 |
| InChIKey | VUPYANPNFUPQQU-UHFFFAOYSA-N |
| SMILES | Cc1cncc(Oc2ccc(C=O)cc2)n1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |