4-(6-methylpyrazin-2-yl)oxybenzoyl chloride structure
|
Common Name | 4-(6-methylpyrazin-2-yl)oxybenzoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 921938-96-7 | Molecular Weight | 248.66500 | |
| Density | 1.314g/cm3 | Boiling Point | 366.1ºC at 760 mmHg | |
| Molecular Formula | C12H9ClN2O2 | Melting Point | 105-108ºC | |
| MSDS | N/A | Flash Point | 175.2ºC | |
| Name | 4-(6-methylpyrazin-2-yl)oxybenzoyl chloride |
|---|
| Density | 1.314g/cm3 |
|---|---|
| Boiling Point | 366.1ºC at 760 mmHg |
| Melting Point | 105-108ºC |
| Molecular Formula | C12H9ClN2O2 |
| Molecular Weight | 248.66500 |
| Flash Point | 175.2ºC |
| Exact Mass | 248.03500 |
| PSA | 52.08000 |
| LogP | 2.95630 |
| Index of Refraction | 1.591 |
| InChIKey | HGYASQNSEYDOEQ-UHFFFAOYSA-N |
| SMILES | Cc1cncc(Oc2ccc(C(=O)Cl)cc2)n1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |