Benzenesulfonamide, 2,4,5-trimethyl- (7CI,9CI) structure
|
Common Name | Benzenesulfonamide, 2,4,5-trimethyl- (7CI,9CI) | ||
|---|---|---|---|---|
| CAS Number | 90643-45-1 | Molecular Weight | 199.27000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H13NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,4,5-trimethylbenzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H13NO2S |
|---|---|
| Molecular Weight | 199.27000 |
| Exact Mass | 199.06700 |
| PSA | 68.54000 |
| LogP | 3.04030 |
| InChIKey | JEUPYYVSBPSDCH-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(S(N)(=O)=O)cc1C |
|
~%
Benzenesulfonam... CAS#:90643-45-1 |
| Literature: Huntress; Autenrieth Journal of the American Chemical Society, 1941 , vol. 63, p. 3446 |
| 2,4,5-Trimethyl-benzolsulfonsaeure-amid |
| 2,4,5-trimethylbenzene-1-sulfonamide |
| 2,4,5-trimethyl-benzenesulfonic acid amide |
| 2.4.5-Trimethyl-benzolsulfonamid |