Beta-Methyl vinyl phosphate structure
|
Common Name | Beta-Methyl vinyl phosphate | ||
|---|---|---|---|---|
| CAS Number | 90776-59-3 | Molecular Weight | 594.506 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 722.4±60.0 °C at 760 mmHg | |
| Molecular Formula | C29H27N2O10P | Melting Point | 129-131ºC | |
| MSDS | N/A | Flash Point | 390.7±32.9 °C | |
| Name | Beta-Methyl Vinyl Phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 722.4±60.0 °C at 760 mmHg |
| Melting Point | 129-131ºC |
| Molecular Formula | C29H27N2O10P |
| Molecular Weight | 594.506 |
| Flash Point | 390.7±32.9 °C |
| Exact Mass | 594.140320 |
| PSA | 167.23000 |
| LogP | 2.13 |
| Vapour Pressure | 0.0±2.5 mmHg at 25°C |
| Index of Refraction | 1.653 |
| InChIKey | STULDTCHQXVRIX-PIYXRGFCSA-N |
| SMILES | CC(O)C1C(=O)N2C(C(=O)OCc3ccc([N+](=O)[O-])cc3)=C(OP(=O)(Oc3ccccc3)Oc3ccccc3)C(C)C12 |
| Storage condition | -20°C Freezer, Under Inert Atmosphere |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933790090 |
| HS Code | 2919900090 |
|---|---|
| Summary | 2919900090 other phosphoric esters and their salts, including lactophosphates; their halogenated, sulphonated, nitrated or nitrosated derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| 4-Nitrobenzyl (4R,5R,6S)-3-[(diphenoxyphosphoryl)oxy]-6-[(1S)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| MFCD01318092 |
| 4-Nitrobenzyl (4R,5R,6S)-3-[(diphenoxyphosphoryl)oxy]-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| 3-(Diphenoxy-phosphoryloxy)-6-(1-hy; droxy-ethyl)-4-methyl-7-oxo-1-aza-b; icyclo[3.2.0]hept-2-ene-2-carboxyli; c acid 4-nitro-benzyl ester |
| 1-Azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid, 3-[(diphenoxyphosphinyl)oxy]-6-[(1S)-1-hydroxyethyl]-4-methyl-7-oxo-, (4-nitrophenyl)methyl ester, (4R,5R,6S)- |
| (4-nitrophenyl)methyl (4R,5R,6S)-3-diphenoxyphosphoryloxy-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| 1-Azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid, 3-[(diphenoxyphosphinyl)oxy]-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-, (4-nitrophenyl)methyl ester, (4R,5R,6S)- |