2-chloro-3-phenyl-butanedioic acid structure
|
Common Name | 2-chloro-3-phenyl-butanedioic acid | ||
|---|---|---|---|---|
| CAS Number | 90798-14-4 | Molecular Weight | 228.62900 | |
| Density | 1.456g/cm3 | Boiling Point | 313.7ºC at 760 mmHg | |
| Molecular Formula | C10H9ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 143.5ºC | |
| Name | 2-chloro-3-phenylbutanedioic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.456g/cm3 |
|---|---|
| Boiling Point | 313.7ºC at 760 mmHg |
| Molecular Formula | C10H9ClO4 |
| Molecular Weight | 228.62900 |
| Flash Point | 143.5ºC |
| Exact Mass | 228.01900 |
| PSA | 74.60000 |
| LogP | 1.54680 |
| Index of Refraction | 1.59 |
| InChIKey | NGZHTYMBEZQKIN-UHFFFAOYSA-N |
| SMILES | O=C(O)C(Cl)C(C(=O)O)c1ccccc1 |
|
~%
2-chloro-3-phen... CAS#:90798-14-4 |
| Literature: Ecke et al. Journal of the American Chemical Society, 1956 , vol. 78, p. 79 |
| 2-chloro-3-phenyl-succinic acid |
| 2-Chlor-3-phenyl-bernsteinsaeure |