Diethyl 2-chloro-3-oxosuccinate structure
|
Common Name | Diethyl 2-chloro-3-oxosuccinate | ||
|---|---|---|---|---|
| CAS Number | 34034-87-2 | Molecular Weight | 222.623 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 271.2±30.0 °C at 760 mmHg | |
| Molecular Formula | C8H11ClO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 108.2±23.6 °C | |
| Name | Diethyl 2-chloro-3-oxosuccinate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 271.2±30.0 °C at 760 mmHg |
| Molecular Formula | C8H11ClO5 |
| Molecular Weight | 222.623 |
| Flash Point | 108.2±23.6 °C |
| Exact Mass | 222.029495 |
| PSA | 69.67000 |
| LogP | 1.28 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.451 |
| InChIKey | JNQWFLVFHCCWPV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)C(Cl)C(=O)OCC |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2918300090 |
| Precursor 7 | |
|---|---|
| DownStream 9 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Diethyl 2-chloro-3-oxobutane-1,4-dioate |
| Butanedioic acid, 2-chloro-3-oxo-, diethyl ester |
| Diethyl 2-chloro-3-oxosuccinate |
| Chlorooxalacetic Acid Diethyl Ester |
| diethyl 3-chloro-2-oxo-butanedioate |
| 2-Chloro-3-oxo-succinic acid diethyl ester |
| diethyl 2-chloro-3-oxobutanedioate |
| ethyl chloro(ethyloxyoxalyl)acetate |
| diethyl 3-chloro-2-oxosuccinate |
| Diethyl chlorooxalacetate |
| 2-chloro-3-oxosuccinic acid diethyl ester |