4-[2-(4-methoxyphenyl)ethenyl]-6-methylchromen-2-one structure
|
Common Name | 4-[2-(4-methoxyphenyl)ethenyl]-6-methylchromen-2-one | ||
|---|---|---|---|---|
| CAS Number | 90834-21-2 | Molecular Weight | 292.32900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[2-(4-methoxyphenyl)ethenyl]-6-methylchromen-2-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H16O3 |
|---|---|
| Molecular Weight | 292.32900 |
| Exact Mass | 292.11000 |
| PSA | 39.44000 |
| LogP | 4.28040 |
| InChIKey | GYVGYDLHIBVHNV-UHFFFAOYSA-N |
| SMILES | COc1ccc(C=Cc2cc(=O)oc3ccc(C)cc23)cc1 |
|
~%
4-[2-(4-methoxy... CAS#:90834-21-2 |
| Literature: Mustafa et al. Journal of the American Chemical Society, 1956 , vol. 78, p. 4692 |
| 2H-1-Benzopyran-2-one,4-[2-(4-methoxyphenyl)ethenyl]-6-methyl |