N-(4-tert-butyl-1,3-thiazol-2-yl)-2-chloroacetamide structure
|
Common Name | N-(4-tert-butyl-1,3-thiazol-2-yl)-2-chloroacetamide | ||
|---|---|---|---|---|
| CAS Number | 908509-16-0 | Molecular Weight | 232.73000 | |
| Density | 1.27g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H13ClN2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(4-tert-butyl-1,3-thiazol-2-yl)-2-chloroacetamide |
|---|
| Density | 1.27g/cm3 |
|---|---|
| Molecular Formula | C9H13ClN2OS |
| Molecular Weight | 232.73000 |
| Exact Mass | 232.04400 |
| PSA | 70.23000 |
| LogP | 2.69090 |
| Index of Refraction | 1.571 |
| InChIKey | FJSAYBPNTHTNBD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1csc(NC(=O)CCl)n1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2934100090 |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |