Bromo(3,4-difluorophenyl)magnesium structure
|
Common Name | Bromo(3,4-difluorophenyl)magnesium | ||
|---|---|---|---|---|
| CAS Number | 90897-92-0 | Molecular Weight | 217.294 | |
| Density | 0.965 g/mL at 25 °C | Boiling Point | 65 °C | |
| Molecular Formula | C6H3BrF2Mg | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 1 °F | |
| Name | magnesium,1,2-difluorobenzene-5-ide,bromide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.965 g/mL at 25 °C |
|---|---|
| Boiling Point | 65 °C |
| Molecular Formula | C6H3BrF2Mg |
| Molecular Weight | 217.294 |
| Flash Point | 1 °F |
| Exact Mass | 215.923660 |
| LogP | 2.61060 |
| Appearance of Characters | Solution | Yellow to dark brown |
| InChIKey | AULUGBNIKQAHPF-UHFFFAOYSA-M |
| SMILES | Fc1c[c-]ccc1F.[Br-].[Mg+2] |
| Storage condition | 2-8°C |
| Water Solubility | Reacts with water. |
| Hazard Codes | F: Flammable;C: Corrosive; |
|---|---|
| Risk Phrases | R11 |
| Safety Phrases | 16-26-33-36/37/39-45 |
| RIDADR | UN 2924 3/PG 2 |
| WGK Germany | 1 |
| Hazard Class | 3.0 |
| HS Code | 29319090 |
|
~%
Bromo(3,4-diflu... CAS#:90897-92-0 |
| Literature: US2009/48213 A1, ; Page/Page column 73 ; |
| 3,4-difluorophenyl magnesium bromide |
| Bromo(3,4-difluorophenyl)magnesium |
| 3,4-diflurphenylmagnesium bromide |
| 3,4-Difluorophenylmagnesium bromide solution |
| Magnesium, bromo(3,4-difluorophenyl)- |
| MFCD00672004 |
| 3,4-Difluorophenylmagnesium bromide 0.5 M in Tetrahydrofuran |
| PC5313 |