7-BENZYL-2,7-DIAZASPIRO[4.4]NONAN-3-ONE structure
|
Common Name | 7-BENZYL-2,7-DIAZASPIRO[4.4]NONAN-3-ONE | ||
|---|---|---|---|---|
| CAS Number | 909723-04-2 | Molecular Weight | 230.30600 | |
| Density | 1.17g/cm3 | Boiling Point | 418.5ºC at 760 mmHg | |
| Molecular Formula | C14H18N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.9ºC | |
| Name | 2-benzyl-2,7-diazaspiro[4.4]nonan-8-one |
|---|
| Density | 1.17g/cm3 |
|---|---|
| Boiling Point | 418.5ºC at 760 mmHg |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.30600 |
| Flash Point | 206.9ºC |
| Exact Mass | 230.14200 |
| PSA | 35.83000 |
| LogP | 1.61240 |
| Index of Refraction | 1.604 |
| InChIKey | WPICAKZZAJHCLQ-UHFFFAOYSA-N |
| SMILES | O=C1CC2(CCN(Cc3ccccc3)C2)CN1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |