7-Benzyl-2-methyl-2,7-diazaspiro[4.4]nonane-1,3,8-trione structure
|
Common Name | 7-Benzyl-2-methyl-2,7-diazaspiro[4.4]nonane-1,3,8-trione | ||
|---|---|---|---|---|
| CAS Number | 91189-25-2 | Molecular Weight | 272.29900 | |
| Density | 1.33g/cm3 | Boiling Point | 528.9ºC at 760 mmHg | |
| Molecular Formula | C15H16N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 262.2ºC | |
| Name | 7-Benzyl-2-methyl-2,7-diazaspiro[4.4]nonane-1,3,8-trione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 528.9ºC at 760 mmHg |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.29900 |
| Flash Point | 262.2ºC |
| Exact Mass | 272.11600 |
| PSA | 57.69000 |
| LogP | 0.66980 |
| Index of Refraction | 1.626 |
| InChIKey | BJXWKDYLCKBAMS-UHFFFAOYSA-N |
| SMILES | CN1C(=O)CC2(CC(=O)N(Cc3ccccc3)C2)C1=O |
|
~%
7-Benzyl-2-meth... CAS#:91189-25-2 |
| Literature: Culbertson, Townley P.; Sanchez, Joseph P.; Gambino, Laura; Sesnie, Josephine A. Journal of Medicinal Chemistry, 1990 , vol. 33, # 8 p. 2270 - 2275 |
|
~%
7-Benzyl-2-meth... CAS#:91189-25-2 |
| Literature: Culbertson, Townley P.; Sanchez, Joseph P.; Gambino, Laura; Sesnie, Josephine A. Journal of Medicinal Chemistry, 1990 , vol. 33, # 8 p. 2270 - 2275 |
|
~%
7-Benzyl-2-meth... CAS#:91189-25-2 |
| Literature: Culbertson, Townley P.; Sanchez, Joseph P.; Gambino, Laura; Sesnie, Josephine A. Journal of Medicinal Chemistry, 1990 , vol. 33, # 8 p. 2270 - 2275 |
| Purine,7-benzyl-2,6-dichloro |
| 7-Benzyl-2,6-dichlor-9H-purin |
| 7-benzyl-2,6-dichloro-7H-purine |
| 2,6-dichloro-7-benzylpurine |
| 2,6-Dichlor-7-benzyl-7H-purin |
| N-7-benzyl-2,6-dichloro-7H-purine |