2-Aminophenol-4-(2-carboxy) sulfonanilide
Modify Date: 2025-08-20 10:47:31
2-Aminophenol-4-(2-carboxy) sulfonanilide structure
|
Common Name | 2-Aminophenol-4-(2-carboxy) sulfonanilide | ||
|---|---|---|---|---|
| CAS Number | 91-35-0 | Molecular Weight | 308.310 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 580.1±60.0 °C at 760 mmHg | |
| Molecular Formula | C13H12N2O5S | Melting Point | >203°C | |
| MSDS | N/A | Flash Point | 304.6±32.9 °C | |
| Name | 2-[(3-amino-4-hydroxyphenyl)sulfonylamino]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 580.1±60.0 °C at 760 mmHg |
| Melting Point | >203°C |
| Molecular Formula | C13H12N2O5S |
| Molecular Weight | 308.310 |
| Flash Point | 304.6±32.9 °C |
| Exact Mass | 308.046692 |
| PSA | 138.10000 |
| LogP | 1.83 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.715 |
| InChIKey | ISDVREGLMJJFJG-UHFFFAOYSA-N |
| SMILES | Nc1cc(S(=O)(=O)Nc2ccccc2C(=O)O)ccc1O |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R36/37/38:Irritating to eyes, respiratory system and skin . |
| Safety Phrases | S26-S36 |
| WGK Germany | 3 |
| HS Code | 2935009090 |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| 2-Aminophenol-4-(2-carboxy) sulfonanilide |
| 2-{[(3-Amino-4-hydroxyphenyl)sulfonyl]amino}benzoic acid |
| MFCD00087624 |
| EINECS 202-063-1 |