methyl 3-[2-nitro-4-(trifluoromethyl)phenoxy]thiophene-2-carboxylate structure
|
Common Name | methyl 3-[2-nitro-4-(trifluoromethyl)phenoxy]thiophene-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 91041-20-2 | Molecular Weight | 347.26700 | |
| Density | 1.492g/cm3 | Boiling Point | 382.1ºC at 760mmHg | |
| Molecular Formula | C13H8F3NO5S | Melting Point | 110-112ºC | |
| MSDS | USA | Flash Point | 184.9ºC | |
| Name | methyl 3-[2-nitro-4-(trifluoromethyl)phenoxy]thiophene-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.492g/cm3 |
|---|---|
| Boiling Point | 382.1ºC at 760mmHg |
| Melting Point | 110-112ºC |
| Molecular Formula | C13H8F3NO5S |
| Molecular Weight | 347.26700 |
| Flash Point | 184.9ºC |
| Exact Mass | 347.00800 |
| PSA | 109.59000 |
| LogP | 4.77720 |
| Index of Refraction | 1.552 |
| InChIKey | SANSDZOSLVQHLX-UHFFFAOYSA-N |
| SMILES | COC(=O)c1sccc1Oc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2934999090 |
|
~81%
methyl 3-[2-nit... CAS#:91041-20-2 |
| Literature: Corral; Lissavetzky; Valdeolmillos Journal of Heterocyclic Chemistry, 1985 , vol. 22, # 5 p. 1349 - 1352 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| hms552e10 |