1-butyl-3-[(5-nitrofuran-2-yl)methylideneamino]urea
![1-butyl-3-[(5-nitrofuran-2-yl)methylideneamino]urea Structure](https://image.chemsrc.com/caspic/428/91060-35-4.png)
1-butyl-3-[(5-nitrofuran-2-yl)methylideneamino]urea structure
|
Common Name | 1-butyl-3-[(5-nitrofuran-2-yl)methylideneamino]urea | ||
|---|---|---|---|---|
| CAS Number | 91060-35-4 | Molecular Weight | 254.24300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H14N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 1-Butyl-3-[(5-nitrofuran-2-yl)methylidenamino]urea (CAS number: 91060-35-4, molecular formula: C10H14N4O4, molecular weight: 254.24300), For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-butyl-3-[(5-nitrofuran-2-yl)methylideneamino]urea |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H14N4O4 |
|---|---|
| Molecular Weight | 254.24300 |
| Exact Mass | 254.10200 |
| PSA | 115.94000 |
| LogP | 2.73950 |
| InChIKey | PZOANRXICRSIRH-KPKJPENVSA-N |
| SMILES | CCCCNC(=O)NN=Cc1ccc([N+](=O)[O-])o1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~79%
1-butyl-3-[(5-n... CAS#:91060-35-4 |
| Literature: Cerecetto, Hugo; Di Maio, Rossanna; Ibarruri, Gerardo; Seoane, Gustavo; Denicola, Ana; Peluffo, Gonzalo; Quijano, Celia; Paulino, Margot Farmaco, 1998 , vol. 53, # 2 p. 89 - 94 |
|
~%
1-butyl-3-[(5-n... CAS#:91060-35-4 |
| Literature: Cerecetto, Hugo; Di Maio, Rossanna; Ibarruri, Gerardo; Seoane, Gustavo; Denicola, Ana; Peluffo, Gonzalo; Quijano, Celia; Paulino, Margot Farmaco, 1998 , vol. 53, # 2 p. 89 - 94 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Hydrazinecarboxamide,N-butyl-2-[(5-nitro-2-furanyl)methylene] |
| 4-butyl-1-(5-nitrofurfurylidene)semicarbazide |
| N(4)-n-butyl-5-nitro-2-furaldehyde semicarbazone |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 1-butyl-3-[(5-nitrofuran-2-yl)methylideneamino]urea have? |
| A: English synonyms of 1-butyl-3-[(5-nitrofuran-2-yl)methylideneamino]urea: Hydrazinecarboxamide,N-butyl-2-[(5-nitro-2-furanyl)methylene], 4-butyl-1-(5-nitrofurfurylidene)semicarbazide, N(4)-n-butyl-5-nitro-2-furaldehyde semicarbazone. |
| Q: What is the molecular weight of 1-butyl-3-[(5-nitrofuran-2-yl)methylideneamino]urea? |
| A: Molecular weight of 1-butyl-3-[(5-nitrofuran-2-yl)methylideneamino]urea is 254.24300. |
| Q: What is the SMILES notation of 1-butyl-3-[(5-nitrofuran-2-yl)methylideneamino]urea? |
| A: SMILES notation of 1-butyl-3-[(5-nitrofuran-2-yl)methylideneamino]urea is CCCCNC(=O)NN=Cc1ccc([N+](=O)[O-])o1. |
| Q: What is the molecular formula of 1-butyl-3-[(5-nitrofuran-2-yl)methylideneamino]urea? |
| A: Molecular formula of 1-butyl-3-[(5-nitrofuran-2-yl)methylideneamino]urea is C10H14N4O4. |
| Q: What is the LogP of 1-butyl-3-[(5-nitrofuran-2-yl)methylideneamino]urea? |
| A: LogP of 1-butyl-3-[(5-nitrofuran-2-yl)methylideneamino]urea is 2.73950. |
| Q: What is the CAS number of 1-butyl-3-[(5-nitrofuran-2-yl)methylideneamino]urea? |
| A: CAS number of 1-butyl-3-[(5-nitrofuran-2-yl)methylideneamino]urea is 91060-35-4. |
| Q: What is the Chinese name of 91060-35-4? |
| A: Chinese name of 91060-35-4 is 91060-35-4. |
| Q: What is the polar surface area (PSA) of 1-butyl-3-[(5-nitrofuran-2-yl)methylideneamino]urea? |
| A: Polar surface area (PSA) of 1-butyl-3-[(5-nitrofuran-2-yl)methylideneamino]urea is 115.94000. |
| Q: What is the InChIKey of 1-butyl-3-[(5-nitrofuran-2-yl)methylideneamino]urea? |
| A: InChIKey of 1-butyl-3-[(5-nitrofuran-2-yl)methylideneamino]urea is PZOANRXICRSIRH-KPKJPENVSA-N. |
| Q: What is the English name of 1-butyl-3-[(5-nitrofuran-2-yl)methylideneamino]urea? |
| A: The English name of 1-butyl-3-[(5-nitrofuran-2-yl)methylideneamino]urea is 1-butyl-3-[(5-nitrofuran-2-yl)methylideneamino]urea. |