5-Nitro-2-furaldehyde diacetate structure
|
Common Name | 5-Nitro-2-furaldehyde diacetate | ||
|---|---|---|---|---|
| CAS Number | 92-55-7 | Molecular Weight | 243.170 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 310.3±42.0 °C at 760 mmHg | |
| Molecular Formula | C9H9NO7 | Melting Point | 89-93 °C | |
| MSDS | N/A | Flash Point | 141.5±27.9 °C | |
| Symbol |
GHS07, GHS08 |
Signal Word | Warning | |
| Name | (5-Nitrofuran-2-yl)methylene diacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 310.3±42.0 °C at 760 mmHg |
| Melting Point | 89-93 °C |
| Molecular Formula | C9H9NO7 |
| Molecular Weight | 243.170 |
| Flash Point | 141.5±27.9 °C |
| Exact Mass | 243.037903 |
| PSA | 111.56000 |
| LogP | 0.18 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.510 |
| InChIKey | HSXKWKJCZNRMJO-UHFFFAOYSA-N |
| SMILES | CC(=O)OC(OC(C)=O)c1ccc([N+](=O)[O-])o1 |
| Storage condition | Refrigerator |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATAMUTATION DATA
|
| Symbol |
GHS07, GHS08 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 + H312 + H332-H351 |
| Precautionary Statements | P261-P280-P301 + P312 + P330 |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | R68 |
| Safety Phrases | S24/25 |
| RIDADR | NONH for all modes of transport |
| RTECS | LU1940000 |
| HS Code | 2932190090 |
|
~99%
5-Nitro-2-fural... CAS#:92-55-7 |
| Literature: Palacios-Grijalva, Laura Nadxieli; Cruz-Gonzalez, Deysi Y.; Lomas-Romero, Leticia; Gonzalez-Zamora, Eduardo; Ulibarri, Gerardo; Negron-Silva, Guillermo E. Molecules, 2009 , vol. 14, # 10 p. 4065 - 4078 |
|
~88%
5-Nitro-2-fural... CAS#:92-55-7 |
| Literature: Balina, Gisela; Kesler, Patricia; Petre, Janet; Pham, Dung; Vollmar, Arnulf Journal of Organic Chemistry, 1986 , vol. 51, # 20 p. 3811 - 3818 |
|
~%
5-Nitro-2-fural... CAS#:92-55-7 |
| Literature: Industrial and Engineering Chemistry, , vol. 47, p. 358,359 Kagaku Kenkyusho Hokoku, , vol. 31, p. 430,434 Chem.Abstr., , p. 15504 |
|
~%
5-Nitro-2-fural... CAS#:92-55-7 |
| Literature: Tohoku J. agric. Res., , vol. 5, p. 147,148 |
|
~%
5-Nitro-2-fural... CAS#:92-55-7 |
| Literature: Journal of Organic Chemistry, , vol. 51, # 20 p. 3811 - 3818 |
| Precursor 6 | |
|---|---|
| DownStream 10 | |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 5-nitro-2-furaldehydediacetate |
| (5-nitrofuran-2-yl)methanediyl diacetate |
| 5-Nitro-2-furanmethanediol diacetate |
| 5-Nitro-2-furaldehyde diacetate |
| Methanediol, 1-(5-nitro-2-furanyl)-, diacetate (ester) |
| EINECS 202-166-1 |
| (5-Nitro-2-furyl)methylene diacetate |
| MFCD00003244 |
| Nifuratel Impurity 1 |