(2R)-2-(5-amino-1,3,4-oxadiazol-2-yl)-1,1,1-trifluorobutan-2-ol structure
|
Common Name | (2R)-2-(5-amino-1,3,4-oxadiazol-2-yl)-1,1,1-trifluorobutan-2-ol | ||
|---|---|---|---|---|
| CAS Number | 910656-46-1 | Molecular Weight | 211.14200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H8F3N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: (2R)-2-(5-amino-1,3,4-oxadiazol-2-yl)-1,1,1-trifluorobutan-2-ol, CAS number 910656-46-1, molecular formula C6H8F3N3O2, molecular weight 211.14200. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2R)-2-(5-amino-1,3,4-oxadiazol-2-yl)-1,1,1-trifluorobutan-2-ol |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H8F3N3O2 |
|---|---|
| Molecular Weight | 211.14200 |
| Exact Mass | 211.05700 |
| PSA | 85.90000 |
| LogP | 0.74180 |
| InChIKey | RKDSYMWBBAVWTJ-RXMQYKEDSA-N |
| SMILES | CCC(O)(c1nnc(N)o1)C(F)(F)F |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2934999090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-(5-amino-[1,3,4]oxadiazol-2-yl)-1,1,1-trifluorobutan-2-ol |
| (R)-2-(5-amino-1,3,4-oxadiazol-2-yl)-1,1,1-trifluorobutan-2-ol |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of (2R)-2-(5-amino-1,3,4-oxadiazol-2-yl)-1,1,1-trifluorobutan-2-ol? |
| A: The English name of (2R)-2-(5-amino-1,3,4-oxadiazol-2-yl)-1,1,1-trifluorobutan-2-ol is (2R)-2-(5-amino-1,3,4-oxadiazol-2-yl)-1,1,1-trifluorobutan-2-ol. |
| Q: What is the molecular formula of (2R)-2-(5-amino-1,3,4-oxadiazol-2-yl)-1,1,1-trifluorobutan-2-ol? |
| A: Molecular formula of (2R)-2-(5-amino-1,3,4-oxadiazol-2-yl)-1,1,1-trifluorobutan-2-ol is C6H8F3N3O2. |
| Q: What is the CAS number of (2R)-2-(5-amino-1,3,4-oxadiazol-2-yl)-1,1,1-trifluorobutan-2-ol? |
| A: CAS number of (2R)-2-(5-amino-1,3,4-oxadiazol-2-yl)-1,1,1-trifluorobutan-2-ol is 910656-46-1. |
| Q: What English synonyms does (2R)-2-(5-amino-1,3,4-oxadiazol-2-yl)-1,1,1-trifluorobutan-2-ol have? |
| A: English synonyms of (2R)-2-(5-amino-1,3,4-oxadiazol-2-yl)-1,1,1-trifluorobutan-2-ol: 2-(5-amino-[1,3,4]oxadiazol-2-yl)-1,1,1-trifluorobutan-2-ol, (R)-2-(5-amino-1,3,4-oxadiazol-2-yl)-1,1,1-trifluorobutan-2-ol. |
| Q: What is the polar surface area (PSA) of (2R)-2-(5-amino-1,3,4-oxadiazol-2-yl)-1,1,1-trifluorobutan-2-ol? |
| A: Polar surface area (PSA) of (2R)-2-(5-amino-1,3,4-oxadiazol-2-yl)-1,1,1-trifluorobutan-2-ol is 85.90000. |
| Q: What is the InChIKey of (2R)-2-(5-amino-1,3,4-oxadiazol-2-yl)-1,1,1-trifluorobutan-2-ol? |
| A: InChIKey of (2R)-2-(5-amino-1,3,4-oxadiazol-2-yl)-1,1,1-trifluorobutan-2-ol is RKDSYMWBBAVWTJ-RXMQYKEDSA-N. |
| Q: What is the LogP of (2R)-2-(5-amino-1,3,4-oxadiazol-2-yl)-1,1,1-trifluorobutan-2-ol? |
| A: LogP of (2R)-2-(5-amino-1,3,4-oxadiazol-2-yl)-1,1,1-trifluorobutan-2-ol is 0.74180. |
| Q: What is the molecular weight of (2R)-2-(5-amino-1,3,4-oxadiazol-2-yl)-1,1,1-trifluorobutan-2-ol? |
| A: Molecular weight of (2R)-2-(5-amino-1,3,4-oxadiazol-2-yl)-1,1,1-trifluorobutan-2-ol is 211.14200. |
| Q: What is the SMILES notation of (2R)-2-(5-amino-1,3,4-oxadiazol-2-yl)-1,1,1-trifluorobutan-2-ol? |
| A: SMILES notation of (2R)-2-(5-amino-1,3,4-oxadiazol-2-yl)-1,1,1-trifluorobutan-2-ol is CCC(O)(c1nnc(N)o1)C(F)(F)F. |