ETHYL 3-AMINO-5-(4-CHLOROPHENYL)THIOPHE& structure
|
Common Name | ETHYL 3-AMINO-5-(4-CHLOROPHENYL)THIOPHE& | ||
|---|---|---|---|---|
| CAS Number | 91076-94-7 | Molecular Weight | 281.75800 | |
| Density | 1.323g/cm3 | Boiling Point | 472.8ºC at 760mmHg | |
| Molecular Formula | C13H12ClNO2S | Melting Point | 107-111ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 239.7ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | ethyl 3-amino-5-(4-chlorophenyl)thiophene-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.323g/cm3 |
|---|---|
| Boiling Point | 472.8ºC at 760mmHg |
| Melting Point | 107-111ºC(lit.) |
| Molecular Formula | C13H12ClNO2S |
| Molecular Weight | 281.75800 |
| Flash Point | 239.7ºC |
| Exact Mass | 281.02800 |
| PSA | 80.56000 |
| LogP | 4.40860 |
| Index of Refraction | 1.62 |
| InChIKey | VOIKQRXCKXHXNF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1sc(-c2ccc(Cl)cc2)cc1N |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335-H413 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2934999090 |
|
~71%
ETHYL 3-AMINO-5... CAS#:91076-94-7 |
| Literature: Shastin; Golubinskii; Lenkova; Balenkova; Nenaidenko Russian Journal of Organic Chemistry, 2006 , vol. 42, # 2 p. 238 - 240 |
|
~%
ETHYL 3-AMINO-5... CAS#:91076-94-7 |
| Literature: Synthesis, , # 8 art. no. Z54010SS, p. 1314 - 1318 |
|
~%
ETHYL 3-AMINO-5... CAS#:91076-94-7 |
| Literature: Synthesis, , # 8 art. no. Z54010SS, p. 1314 - 1318 |
|
~%
ETHYL 3-AMINO-5... CAS#:91076-94-7 |
| Literature: Synthesis, , # 3 p. 275 - 276 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD06336766 |
| 2-Ethoxycarbonyl-3-amino-5-(4-chlorophenyl)-thiophene |
| 5-(p-chlorophenyl)-3-amino-thiophene-2-carboxylic acid ethyl esther |