1-(3,4-dichlorophenyl)ethenoxy-trimethylsilane
1-(3,4-dichlorophenyl)ethenoxy-trimethylsilane structure
|
Common Name | 1-(3,4-dichlorophenyl)ethenoxy-trimethylsilane | ||
|---|---|---|---|---|
| CAS Number | 91077-75-7 | Molecular Weight | 261.22000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H14Cl2OSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 1-(3,4-Dichlorophenyl)ethenoxy-trimethylsilane, Chinese name: 1-(3,4-二氯苯基)乙烯氧基三甲基硅烷, CAS number: 91077-75-7, molecular formula: C11H14Cl2OSi, molecular weight: 261.22000. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(3,4-dichlorophenyl)ethenoxy-trimethylsilane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H14Cl2OSi |
|---|---|
| Molecular Weight | 261.22000 |
| Exact Mass | 260.01900 |
| PSA | 9.23000 |
| LogP | 4.81560 |
| InChIKey | LJVCFOBIHFEASD-UHFFFAOYSA-N |
| SMILES | C=C(O[Si](C)(C)C)c1ccc(Cl)c(Cl)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~93%
1-(3,4-dichloro... CAS#:91077-75-7 |
| Literature: Shipov, A. G.; Orlova, N. A.; Savostyanova, I. A.; Artamkina, O. B.; Baukov, Yu. I. J. Gen. Chem. USSR (Engl. Transl.), 1989 , vol. 59, # 5.2 p. 1084 - 1099,959 - 971 |
|
~%
1-(3,4-dichloro... CAS#:91077-75-7 |
| Literature: Steinbaugh; Hamilton; Prasad; Para; Tummino; Ferguson; Lunney; Blankley Bioorganic and Medicinal Chemistry Letters, 1996 , vol. 6, # 10 p. 1099 - 1104 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Silane,[[1-(3,4-dichlorophenyl)ethenyl]oxy]trimethyl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 1-(3,4-dichlorophenyl)ethenoxy-trimethylsilane? |
| A: Molecular formula of 1-(3,4-dichlorophenyl)ethenoxy-trimethylsilane is C11H14Cl2OSi. |
| Q: What is the Chinese name of 91077-75-7? |
| A: Chinese name of 91077-75-7 is 91077-75-7. |
| Q: What is the English name of 1-(3,4-dichlorophenyl)ethenoxy-trimethylsilane? |
| A: The English name of 1-(3,4-dichlorophenyl)ethenoxy-trimethylsilane is 1-(3,4-dichlorophenyl)ethenoxy-trimethylsilane. |
| Q: What is the molecular weight of 1-(3,4-dichlorophenyl)ethenoxy-trimethylsilane? |
| A: Molecular weight of 1-(3,4-dichlorophenyl)ethenoxy-trimethylsilane is 261.22000. |
| Q: What is the InChIKey of 1-(3,4-dichlorophenyl)ethenoxy-trimethylsilane? |
| A: InChIKey of 1-(3,4-dichlorophenyl)ethenoxy-trimethylsilane is LJVCFOBIHFEASD-UHFFFAOYSA-N. |
| Q: What English synonyms does 1-(3,4-dichlorophenyl)ethenoxy-trimethylsilane have? |
| A: English synonyms of 1-(3,4-dichlorophenyl)ethenoxy-trimethylsilane: Silane,[[1-(3,4-dichlorophenyl)ethenyl]oxy]trimethyl. |
| Q: What is the LogP of 1-(3,4-dichlorophenyl)ethenoxy-trimethylsilane? |
| A: LogP of 1-(3,4-dichlorophenyl)ethenoxy-trimethylsilane is 4.81560. |
| Q: What is the CAS number of 1-(3,4-dichlorophenyl)ethenoxy-trimethylsilane? |
| A: CAS number of 1-(3,4-dichlorophenyl)ethenoxy-trimethylsilane is 91077-75-7. |
| Q: What is the SMILES notation of 1-(3,4-dichlorophenyl)ethenoxy-trimethylsilane? |
| A: SMILES notation of 1-(3,4-dichlorophenyl)ethenoxy-trimethylsilane is C=C(O[Si](C)(C)C)c1ccc(Cl)c(Cl)c1. |
| Q: What is the polar surface area (PSA) of 1-(3,4-dichlorophenyl)ethenoxy-trimethylsilane? |
| A: Polar surface area (PSA) of 1-(3,4-dichlorophenyl)ethenoxy-trimethylsilane is 9.23000. |