2-methoxy-3-nitronaphthalene structure
|
Common Name | 2-methoxy-3-nitronaphthalene | ||
|---|---|---|---|---|
| CAS Number | 91137-51-8 | Molecular Weight | 203.19400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H9NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-methoxy-3-nitronaphthalene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H9NO3 |
|---|---|
| Molecular Weight | 203.19400 |
| Exact Mass | 203.05800 |
| PSA | 55.05000 |
| LogP | 3.27980 |
| InChIKey | GKQHULHPBJRLTG-UHFFFAOYSA-N |
| SMILES | COc1cc2ccccc2cc1[N+](=O)[O-] |
|
~%
2-methoxy-3-nit... CAS#:91137-51-8 |
| Literature: Woodcock; Clifford Journal of the Chemical Society, 1957 , p. 4139 |
|
~%
2-methoxy-3-nit... CAS#:91137-51-8 |
| Literature: Woodcock; Clifford Journal of the Chemical Society, 1957 , p. 4139 |
| methyl-(3-nitro-[2]naphthyl)-ether |
| Methyl-(3-nitro-[2]naphthyl)-aether |
| 3-Nitro-2-methoxy-naphthaln |