5-Methyl-1-phenylpyrazole-4-carboxylic Acid structure
|
Common Name | 5-Methyl-1-phenylpyrazole-4-carboxylic Acid | ||
|---|---|---|---|---|
| CAS Number | 91138-00-0 | Molecular Weight | 202.20900 | |
| Density | 1.24 g/cm3 | Boiling Point | 382.9ºC at 760 mmHg | |
| Molecular Formula | C11H10N2O2 | Melting Point | 166-170 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 185.4ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 5-methyl-1-phenyl-1h-pyrazole-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24 g/cm3 |
|---|---|
| Boiling Point | 382.9ºC at 760 mmHg |
| Melting Point | 166-170 °C(lit.) |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.20900 |
| Flash Point | 185.4ºC |
| Exact Mass | 202.07400 |
| PSA | 55.12000 |
| LogP | 1.87890 |
| Index of Refraction | 1.617 |
| InChIKey | USSMIQWDLWJQDQ-UHFFFAOYSA-N |
| SMILES | Cc1c(C(=O)O)cnn1-c1ccccc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933199090 |
|
~92%
5-Methyl-1-phen... CAS#:91138-00-0 |
| Literature: Menozzi; Mosti; Schenone Journal of Heterocyclic Chemistry, 1987 , vol. 24, # 6 p. 1669 - 1675 |
|
~%
5-Methyl-1-phen... CAS#:91138-00-0 |
| Literature: Journal of Heterocyclic Chemistry, , vol. 24, # 6 p. 1669 - 1675 |
|
~%
5-Methyl-1-phen... CAS#:91138-00-0 |
| Literature: Gazzetta Chimica Italiana, , vol. 23 I, p. 313,315 Gazzetta Chimica Italiana, , vol. 28 I, p. 388 |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD00067831 |
| 5-methyl-1-phenylpyrazole-4-carboxylic acid |