5-(4-Bromo-Phenyl)-3-Methyl-Isoxazole-4-Carboxylic Acid structure
|
Common Name | 5-(4-Bromo-Phenyl)-3-Methyl-Isoxazole-4-Carboxylic Acid | ||
|---|---|---|---|---|
| CAS Number | 91182-60-4 | Molecular Weight | 282.090 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 408.6±40.0 °C at 760 mmHg | |
| Molecular Formula | C11H8BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200.9±27.3 °C | |
| Name | 5-(4-bromophenyl)-3-methyl-1,2-oxazole-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 408.6±40.0 °C at 760 mmHg |
| Molecular Formula | C11H8BrNO3 |
| Molecular Weight | 282.090 |
| Flash Point | 200.9±27.3 °C |
| Exact Mass | 280.968750 |
| PSA | 63.33000 |
| LogP | 2.82 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.607 |
| InChIKey | GFLKZFOUAHOGJF-UHFFFAOYSA-N |
| SMILES | Cc1noc(-c2ccc(Br)cc2)c1C(=O)O |
| Storage condition | 2-8℃ |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2934999090 |
|
~95%
5-(4-Bromo-Phen... CAS#:91182-60-4 |
| Literature: Gerritz, Samuel; Shi, Shuhao; Zhu, Shirong Patent: US2006/287287 A1, 2006 ; Location in patent: Page/Page column 31-32 ; US 20060287287 A1 |
|
~%
5-(4-Bromo-Phen... CAS#:91182-60-4 |
| Literature: INTERMUNE, INC.; BUCKMAN, Brad, O.; NICHOLAS, John, B.; EMAYAN, Kumaraswamy; SEIWERT, Scott, D. Patent: WO2013/25733 A1, 2013 ; |
|
~%
5-(4-Bromo-Phen... CAS#:91182-60-4 |
| Literature: INTERMUNE, INC.; BUCKMAN, Brad, O.; NICHOLAS, John, B.; EMAYAN, Kumaraswamy; SEIWERT, Scott, D. Patent: WO2013/25733 A1, 2013 ; |
|
~%
5-(4-Bromo-Phen... CAS#:91182-60-4 |
| Literature: Doyle,F.P. et al. Journal of the Chemical Society, 1963 , p. 5838 - 5845 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Methyl-4-carboxy-5-(4-brom-phenyl)-isoxazol |
| 4-Isoxazolecarboxylic acid, 5-(4-bromophenyl)-3-methyl- |
| 5-(4-Bromophenyl)-3-methylisoxazole-4-carboxylic acid |
| 5-(4-Bromophenyl)-3-methyl-4-isoxazolecarboxylic acid |
| 5-(4-Bromophenyl)-3-methyl-1,2-oxazole-4-carboxylic acid |