(4,7,7-trimethyl-3-oxo-norbornan-2-yl)thiourea structure
|
Common Name | (4,7,7-trimethyl-3-oxo-norbornan-2-yl)thiourea | ||
|---|---|---|---|---|
| CAS Number | 91216-27-2 | Molecular Weight | 226.33800 | |
| Density | 1.19g/cm3 | Boiling Point | 338.5ºC at 760 mmHg | |
| Molecular Formula | C11H18N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.5ºC | |
| Name | (4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl)thiourea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 338.5ºC at 760 mmHg |
| Molecular Formula | C11H18N2OS |
| Molecular Weight | 226.33800 |
| Flash Point | 158.5ºC |
| Exact Mass | 226.11400 |
| PSA | 87.21000 |
| LogP | 2.30460 |
| Index of Refraction | 1.586 |
| InChIKey | WAJXVMMWLBDPGD-UHFFFAOYSA-N |
| SMILES | CC12CCC(C(NC(N)=S)C1=O)C2(C)C |
|
~%
(4,7,7-trimethy... CAS#:91216-27-2 |
| Literature: Forster; Jackson Journal of the Chemical Society, 1907 , vol. 91, p. 1888 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| (Campheryl-(3))-thioharnstoff |
| 3-Thioureido-campher |
| ((1R)-2-oxo-bornane-3endo-yl)-thiourea |
| ((1R)-2-Oxo-bornan-3endo-yl)-thioharnstoff |