1-N-Boc-3-(S)-Methylamino-piperidine structure
|
Common Name | 1-N-Boc-3-(S)-Methylamino-piperidine | ||
|---|---|---|---|---|
| CAS Number | 912368-73-1 | Molecular Weight | 214.305 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 289.0±33.0 °C at 760 mmHg | |
| Molecular Formula | C11H22N2O2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 128.6±25.4 °C | |
| Symbol |
GHS06, GHS09 |
Signal Word | Danger | |
| Name | (S)-tert-Butyl 3-(methylamino)piperidine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 289.0±33.0 °C at 760 mmHg |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.305 |
| Flash Point | 128.6±25.4 °C |
| Exact Mass | 214.168121 |
| PSA | 41.57000 |
| LogP | 0.95 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.485 |
| InChIKey | XRRRUOWSHGFPTI-VIFPVBQESA-N |
| SMILES | CNC1CCCN(C(=O)OC(C)(C)C)C1 |
| Symbol |
GHS06, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H319-H400 |
| Precautionary Statements | P273-P301 + P310-P305 + P351 + P338 |
| Hazard Codes | T+ |
| RIDADR | UN 2811 6.1 / PGIII |
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-Piperidinecarboxylic acid, 3-(methylamino)-, 1,1-dimethylethyl ester, (3S)- |
| tert-butyl (3S)-3-(methylamino)piperidine-1-carboxylate |
| 2-Methyl-2-propanyl (3S)-3-(methylamino)-1-piperidinecarboxylate |
| 1-N-Boc-3-(S)-Methylamino-piperidine |