Diethylstilbestrol-d8 structure
|
Common Name | Diethylstilbestrol-d8 | ||
|---|---|---|---|---|
| CAS Number | 91318-10-4 | Molecular Weight | 276.39900 | |
| Density | 1.141g/cm3 | Boiling Point | 407.102ºC at 760 mmHg | |
| Molecular Formula | C18H12D8O2 | Melting Point | 169-172ºC | |
| MSDS | N/A | Flash Point | 186.946ºC | |
| Name | diethyl-1,1,1',1'-d4-stilbestrol-3,3',5,5'-d4 |
|---|---|
| Synonym | More Synonyms |
| Description |
|---|
| Density | 1.141g/cm3 |
|---|---|
| Boiling Point | 407.102ºC at 760 mmHg |
| Melting Point | 169-172ºC |
| Molecular Formula | C18H12D8O2 |
| Molecular Weight | 276.39900 |
| Flash Point | 186.946ºC |
| Exact Mass | 276.19700 |
| PSA | 40.46000 |
| LogP | 4.82860 |
| Index of Refraction | 1.603 |
| InChIKey | RGLYKWWBQGJZGM-XWCVKCCGSA-N |
| SMILES | CCC(=C(CC)c1ccc(O)cc1)c1ccc(O)cc1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| Hazard Class | 3、6.1 |
|
~%
Diethylstilbest... CAS#:91318-10-4 |
| Literature: Oda; Sato; Kodama; Saito Chemical and Pharmaceutical Bulletin, 1990 , vol. 38, # 9 p. 2397 - 2399 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| <4(R)-(2)H>NADPH |
| Me3SiC6H4-p-NMe2 |
| N,N-Dimethyl-p-(trimethylsilyl)aniline |
| [4,4',6,6',8,8'-2H8] trans-diethylstilbesterol |
| N,N-dimethyl-4-(trimethylsilyl)aniline |
| <4-(N,N-dimethylamino)phenyl>trimethylsilane |
| 4-(trimethylsilyl)-N,N-dimethylaniline |
| 1-Dimethylamino-4-trimethylsilylbenzene |
| p-(Trimethylsilyl)-N,N-dimethylaniline |
| (4R)-<4-2H>NADPH |
| Aniline,N,N-dimethyl-p-(trimethylsilyl)-(6CI,7CI,8CI) |
| Trimethyl-(4-N,N-dimethylphenyl)silane |
| Benzenamine,N,N-dimethyl-4-(trimethylsilyl) |
| N,N-dimethyl-4-trimethylsilanyl-aniline |
| p-(CH3)2NC6H4Si(CH3)3 |
| E-2,2,3',3'',5,5,5',5''-octadeuteriodiethylstilbestrol |
| p-Dimethylaminophenyltrimethylsilane |
| (4R)-<4-(2)H1>-NADPH |