3-Bromo-5-carboxyphenylboronic acid structure
|
Common Name | 3-Bromo-5-carboxyphenylboronic acid | ||
|---|---|---|---|---|
| CAS Number | 913835-73-1 | Molecular Weight | 244.83500 | |
| Density | 1.869g/cm3 | Boiling Point | 480.728ºC at 760 mmHg | |
| Molecular Formula | C7H6BBrO4 | Melting Point | 290-292ºC | |
| MSDS | Chinese USA | Flash Point | 244.536ºC | |
| Name | 3-Bromo-5-carboxyphenylboronic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.869g/cm3 |
|---|---|
| Boiling Point | 480.728ºC at 760 mmHg |
| Melting Point | 290-292ºC |
| Molecular Formula | C7H6BBrO4 |
| Molecular Weight | 244.83500 |
| Flash Point | 244.536ºC |
| Exact Mass | 243.95400 |
| PSA | 77.76000 |
| Index of Refraction | 1.641 |
| InChIKey | CWBLIPMCDMSOFX-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(Br)cc(B(O)O)c1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| RIDADR | NONH for all modes of transport |
|
~80%
3-Bromo-5-carbo... CAS#:913835-73-1 |
| Literature: Kurach, Pawel; Lulinski, Sergiusz; Serwatowski, Janusz European Journal of Organic Chemistry, 2008 , # 18 p. 3171 - 3178 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-borono-5-bromobenzoic acid |