isotrichodermin structure
|
Common Name | isotrichodermin | ||
|---|---|---|---|---|
| CAS Number | 91423-90-4 | Molecular Weight | 249.31000 | |
| Density | 1.19g/cm3 | Boiling Point | 371.2ºC at 760 mmHg | |
| Molecular Formula | C16H15N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 161ºC | |
| Name | 5-(2,4-dimethylphenyl)-3-phenyl-1H-1,2,4-triazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 371.2ºC at 760 mmHg |
| Molecular Formula | C16H15N3 |
| Molecular Weight | 249.31000 |
| Flash Point | 161ºC |
| Exact Mass | 249.12700 |
| PSA | 41.57000 |
| LogP | 3.75550 |
| Index of Refraction | 1.545 |
| InChIKey | OZXJPPYWZVBMGW-DJXIOKRSSA-N |
| SMILES | CC(=O)OC1CC2(C)C3(C)CCC(C)=CC3OC1C21CO1 |
|
~%
isotrichodermin CAS#:91423-90-4 |
| Literature: Tokai, Takeshi; Takahashi-Ando, Naoko; Izawa, Masumi; Kamakura, Takashi; Yoshida, Minoru; Fujimura, Makoto; Kimura, Makoto Bioscience, Biotechnology and Biochemistry, 2008 , vol. 72, # 9 p. 2485 - 2489 |
| s-Triazole,5-phenyl-3-(2,4-xylyl) |
| 1H-1,2,4-Triazole,3-(2,4-dimethylphenyl)-5-phenyl |
| 5-Phenyl-3-(2,4-xylyl)-s-triazole |
| Isotrichodermin |