N,N-di(butan-2-yl)-4-phenylbutanamide structure
|
Common Name | N,N-di(butan-2-yl)-4-phenylbutanamide | ||
|---|---|---|---|---|
| CAS Number | 91424-77-0 | Molecular Weight | 275.42900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H29NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N,N-di(butan-2-yl)-4-phenylbutanamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H29NO |
|---|---|
| Molecular Weight | 275.42900 |
| Exact Mass | 275.22500 |
| PSA | 20.31000 |
| LogP | 4.43490 |
| InChIKey | ASAQNUSEDWVAIY-UHFFFAOYSA-N |
| SMILES | CCC(C)N(C(=O)CCCc1ccccc1)C(C)CC |
|
~69%
N,N-di(butan-2-... CAS#:91424-77-0 |
| Literature: Al-Jallo; Hussain; Mansoor; Sameh; Al-Saidi Journal of Chemical and Engineering Data, 1984 , vol. 29, # 4 p. 479 - 481 |
| N,N-DI(SEC-BUTYL)4-PHENYLBUTANAMIDE |
| Benzenebutanamide,N,N-bis(1-methylpropyl) |