Urea,N'-(2,4-dimethylphenyl)-N,N-dimethyl- structure
|
Common Name | Urea,N'-(2,4-dimethylphenyl)-N,N-dimethyl- | ||
|---|---|---|---|---|
| CAS Number | 91430-05-6 | Molecular Weight | 192.25800 | |
| Density | 1.075g/cm3 | Boiling Point | 348ºC at 760mmHg | |
| Molecular Formula | C11H16N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 164.3ºC | |
| Name | 3-(2,4-dimethylphenyl)-1,1-dimethylurea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.075g/cm3 |
|---|---|
| Boiling Point | 348ºC at 760mmHg |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.25800 |
| Flash Point | 164.3ºC |
| Exact Mass | 192.12600 |
| PSA | 32.34000 |
| LogP | 2.46990 |
| Index of Refraction | 1.568 |
| InChIKey | VTERNVHPRDIZBC-UHFFFAOYSA-N |
| SMILES | Cc1ccc(NC(=O)N(C)C)c(C)c1 |
| HS Code | 2924299090 |
|---|
|
~%
Urea,N'-(2,4-di... CAS#:91430-05-6 |
| Literature: Franz,R.A. et al. Journal of Organic Chemistry, 1962 , vol. 27, p. 4341 - 4346 |
|
~%
Urea,N'-(2,4-di... CAS#:91430-05-6 |
| Literature: Monsanto Chem.Co. Patent: US2857430 , 1956 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N'-(2,4-dimethyl-phenyl)-N,N-dimethyl-urea |
| 1-(2,4-dimethylphenyl)-3,3-dimethylurea |
| 1,1-Dimethyl-3-<2,4-dimethyl-phenyl>-harnstoff |
| N'-(2,4-Dimethyl-phenyl)-N,N-dimethyl-harnstoff |