2-(4-Methoxyphenyl)thiazole-5-carbaldehyde structure
|
Common Name | 2-(4-Methoxyphenyl)thiazole-5-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 914348-82-6 | Molecular Weight | 219.26000 | |
| Density | 1.267g/cm3 | Boiling Point | 387.586ºC at 760 mmHg | |
| Molecular Formula | C11H9NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.205ºC | |
| Name | 2-(4-methoxyphenyl)-1,3-thiazole-5-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.267g/cm3 |
|---|---|
| Boiling Point | 387.586ºC at 760 mmHg |
| Molecular Formula | C11H9NO2S |
| Molecular Weight | 219.26000 |
| Flash Point | 188.205ºC |
| Exact Mass | 219.03500 |
| PSA | 67.43000 |
| LogP | 2.63120 |
| Index of Refraction | 1.619 |
| InChIKey | DFJPGTVCVKDDEY-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2ncc(C=O)s2)cc1 |
| HS Code | 2934100090 |
|---|
|
~78%
2-(4-Methoxyphe... CAS#:914348-82-6 |
| Literature: Daiichi Sankyo Company, Limited Patent: EP2308838 A1, 2011 ; Location in patent: Page/Page column 69 ; |
|
~%
2-(4-Methoxyphe... CAS#:914348-82-6 |
| Literature: EP2308838 A1, ; |
|
~78%
2-(4-Methoxyphe... CAS#:914348-82-6 |
| Literature: Daiichi Sankyo Company, Limited Patent: EP2308838 A1, 2011 ; Location in patent: Page/Page column 69 ; |
|
~%
2-(4-Methoxyphe... CAS#:914348-82-6 |
| Literature: Daiichi Sankyo Company, Limited Patent: EP2308838 A1, 2011 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2-(4-methoxyphenyl)thiazole-5-carbaldehyde |
| 2-(2-pyridyl)-gammabutyrolactone |