1-Boc-3-bromo-5-methylindole structure
|
Common Name | 1-Boc-3-bromo-5-methylindole | ||
|---|---|---|---|---|
| CAS Number | 914349-24-9 | Molecular Weight | 310.18600 | |
| Density | 1.34g/cm3 | Boiling Point | 384.6ºC at 760 mmHg | |
| Molecular Formula | C14H16BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186.4ºC | |
| Name | tert-butyl 3-bromo-5-methylindole-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 384.6ºC at 760 mmHg |
| Molecular Formula | C14H16BrNO2 |
| Molecular Weight | 310.18600 |
| Flash Point | 186.4ºC |
| Exact Mass | 309.03600 |
| PSA | 31.23000 |
| LogP | 4.49540 |
| Index of Refraction | 1.57 |
| InChIKey | OZMQFZLYHMJMSA-UHFFFAOYSA-N |
| SMILES | Cc1ccc2c(c1)c(Br)cn2C(=O)OC(C)(C)C |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-Boc-3-Bromo-5-methylindole |
| OR1714 |
| MFCD05864764 |