1-Boc-3-Bromo-5-methoxyindole structure
|
Common Name | 1-Boc-3-Bromo-5-methoxyindole | ||
|---|---|---|---|---|
| CAS Number | 348640-11-9 | Molecular Weight | 326.186 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 403.8±48.0 °C at 760 mmHg | |
| Molecular Formula | C14H16BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.0±29.6 °C | |
| Name | tert-butyl 3-bromo-5-methoxyindole-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 403.8±48.0 °C at 760 mmHg |
| Molecular Formula | C14H16BrNO3 |
| Molecular Weight | 326.186 |
| Flash Point | 198.0±29.6 °C |
| Exact Mass | 325.031342 |
| PSA | 40.46000 |
| LogP | 4.55 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.564 |
| InChIKey | DCTZDUWRIAYEIF-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(c1)c(Br)cn2C(=O)OC(C)(C)C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
|
~%
1-Boc-3-Bromo-5... CAS#:348640-11-9 |
| Literature: US2004/9983 A1, ; Page/Page column 108 ; |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Indole-1-carboxylic acid, 3-bromo-5-methoxy-, 1,1-dimethylethyl ester |
| 3-bromo-5-methoxy-indole-1-carboxylic acid tert-butyl ester |
| 2-Methyl-2-propanyl 3-bromo-5-methoxy-1H-indole-1-carboxylate |
| 1-Boc-3-Bromo-5-methoxyindole |
| 3-Bromo-5-methoxyindole,N-BOC protected |
| tert-Butyl 3-bromo-5-methoxy-1H-indole-1-carboxylate |