4-(4-Ethylpiperazin-1-ylmethyl)benzylamine structure
|
Common Name | 4-(4-Ethylpiperazin-1-ylmethyl)benzylamine | ||
|---|---|---|---|---|
| CAS Number | 914349-67-0 | Molecular Weight | 233.352 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 351.8±32.0 °C at 760 mmHg | |
| Molecular Formula | C14H23N3 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 164.1±19.9 °C | |
| Name | 4-(4-Ethylpiperazin-1-ylmethyl)benzylamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 351.8±32.0 °C at 760 mmHg |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.352 |
| Flash Point | 164.1±19.9 °C |
| Exact Mass | 233.189194 |
| PSA | 32.50000 |
| LogP | 0.32 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.560 |
| InChIKey | SAUDSDDZIRPWMO-UHFFFAOYSA-N |
| SMILES | CCN1CCN(Cc2ccc(CN)cc2)CC1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933599090 |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| [4-[(4-ethylpiperazin-1-yl)methyl]phenyl]methanamine |
| Benzenemethanamine, 4-[(4-ethyl-1-piperazinyl)methyl]- |
| 1-{4-[(4-Ethyl-1-piperazinyl)methyl]phenyl}methanamine |
| 1-{4-[(4-ethylpiperazin-1-yl)methyl]phenyl}methanamine |