Tefinostat structure
|
Common Name | Tefinostat | ||
|---|---|---|---|---|
| CAS Number | 914382-60-8 | Molecular Weight | 495.61000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H37N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of TefinostatTefinostat (CHR-2845) is a monocyte/macrophage-targeted pan HDAC inhibitor, cleaved into active acid CHR-2847 by the intracellular esterase human carboxylesterase-1 (hCE-1). Anti-monocytoid lineage leukaemias activity[1]. |
| Name | cyclopentyl (2S)-2-[[4-[[8-(hydroxyamino)-8-oxooctanoyl]amino]phenyl]methylamino]-2-phenylacetate |
|---|---|
| Synonym | More Synonyms |
| Description | Tefinostat (CHR-2845) is a monocyte/macrophage-targeted pan HDAC inhibitor, cleaved into active acid CHR-2847 by the intracellular esterase human carboxylesterase-1 (hCE-1). Anti-monocytoid lineage leukaemias activity[1]. |
|---|---|
| Related Catalog | |
| Target |
HDAC |
| References |
| Molecular Formula | C28H37N3O5 |
|---|---|
| Molecular Weight | 495.61000 |
| Exact Mass | 495.27300 |
| PSA | 120.25000 |
| LogP | 6.09200 |
| InChIKey | GLNWREBYRLDPQP-MHZLTWQESA-N |
| SMILES | O=C(CCCCCCC(=O)Nc1ccc(CNC(C(=O)OC2CCCC2)c2ccccc2)cc1)NO |
| Tefinostat |