tert-butyl 2,2,3,3,4,4,4-heptafluorobutaneperoxoate structure
|
Common Name | tert-butyl 2,2,3,3,4,4,4-heptafluorobutaneperoxoate | ||
|---|---|---|---|---|
| CAS Number | 91481-65-1 | Molecular Weight | 286.14400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H9F7O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tert-butyl 2,2,3,3,4,4,4-heptafluorobutaneperoxoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H9F7O3 |
|---|---|
| Molecular Weight | 286.14400 |
| Exact Mass | 286.04400 |
| PSA | 35.53000 |
| LogP | 3.09260 |
| InChIKey | IEIUNVABWRASPD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OOC(=O)C(F)(F)C(F)(F)C(F)(F)F |
|
~%
tert-butyl 2,2,... CAS#:91481-65-1 |
| Literature: Sawada, Hideo; Hagii, Hidehiko; Aoshima, Kazuyoshi; Arai, Takeshi Bulletin of the Chemical Society of Japan, 1984 , vol. 57, # 4 p. 1161 - 1162 |
| Butaneperoxoic acid,heptafluoro-,1,1-dimethylethyl ester |
| t-butyl heptafluoroperoxybutyrate |