3-(3,3-dimethylbutanoylamino)-4-methylbenzoic acid
Modify Date: 2025-09-20 10:10:07
3-(3,3-dimethylbutanoylamino)-4-methylbenzoic acid structure
|
Common Name | 3-(3,3-dimethylbutanoylamino)-4-methylbenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 915921-64-1 | Molecular Weight | 249.30600 | |
| Density | 1.147g/cm3 | Boiling Point | 441.144ºC at 760 mmHg | |
| Molecular Formula | C14H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.596ºC | |
| Name | 3-(3,3-dimethylbutanoylamino)-4-methylbenzoic acid |
|---|
| Density | 1.147g/cm3 |
|---|---|
| Boiling Point | 441.144ºC at 760 mmHg |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.30600 |
| Flash Point | 220.596ºC |
| Exact Mass | 249.13600 |
| PSA | 66.40000 |
| LogP | 3.14090 |
| Index of Refraction | 1.565 |
| InChIKey | IQZBVCIRKSIHQY-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)O)cc1NC(=O)CC(C)(C)C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |