3-chloro-N-(4-methoxy-2-methylphenyl)propanamide
Modify Date: 2025-08-26 19:16:05
3-chloro-N-(4-methoxy-2-methylphenyl)propanamide structure
|
Common Name | 3-chloro-N-(4-methoxy-2-methylphenyl)propanamide | ||
|---|---|---|---|---|
| CAS Number | 915921-70-9 | Molecular Weight | 227.68700 | |
| Density | 1.194g/cm3 | Boiling Point | 389.611ºC at 760 mmHg | |
| Molecular Formula | C11H14ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-chloro-N-(4-methoxy-2-methylphenyl)propanamide |
|---|
| Density | 1.194g/cm3 |
|---|---|
| Boiling Point | 389.611ºC at 760 mmHg |
| Molecular Formula | C11H14ClNO2 |
| Molecular Weight | 227.68700 |
| Exact Mass | 227.07100 |
| PSA | 38.33000 |
| LogP | 2.64400 |
| Index of Refraction | 1.558 |
| InChIKey | RHRZNQDYJFZOBS-UHFFFAOYSA-N |
| SMILES | COc1ccc(NC(=O)CCCl)c(C)c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |