2-Chloro-4,6-bis[3-(perfluorohexyl)propyloxy]-1,3,5-triazine structure
|
Common Name | 2-Chloro-4,6-bis[3-(perfluorohexyl)propyloxy]-1,3,5-triazine | ||
|---|---|---|---|---|
| CAS Number | 916770-15-5 | Molecular Weight | 867.75000 | |
| Density | 1.62g/cm3 | Boiling Point | 453.5ºC at 760 mmHg | |
| Molecular Formula | C21H12ClF26N3O2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-chloro-4,6-bis(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononoxy)-1,3,5-triazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.62g/cm3 |
|---|---|
| Boiling Point | 453.5ºC at 760 mmHg |
| Molecular Formula | C21H12ClF26N3O2 |
| Molecular Weight | 867.75000 |
| Exact Mass | 867.02000 |
| PSA | 57.13000 |
| LogP | 10.32060 |
| Index of Refraction | 1.355 |
| InChIKey | CBCNBGCPSUHKHN-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCCOc1nc(Cl)nc(OCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)n1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| 2-Chloro-4,6-bis[3-(perfluorohexyl)propyloxy]-1,3,5-triazine |
| 2-Chloro-4,6-bis(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononyloxy)-1,3,5-triazine |
| F26 CDMT |