Dimethylcurcumin 4Z-enol structure
|
Common Name | Dimethylcurcumin 4Z-enol | ||
|---|---|---|---|---|
| CAS Number | 917813-54-8 | Molecular Weight | 396.433 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 588.6±50.0 °C at 760 mmHg | |
| Molecular Formula | C23H24O6 | Melting Point | 129-130ºC | |
| MSDS | N/A | Flash Point | 201.8±23.6 °C | |
Use of Dimethylcurcumin 4Z-enolASC-J9, is antitumor agent. ASC-J9 suppresses castration-resistant prostate cancer growth via degradation of full-length and splice variant androgen receptors. |
| Name | 1,7-Bis-(3,4-dimethoxy-phenyl)-5-hydroxy-hepta-1,4,6-trien-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 588.6±50.0 °C at 760 mmHg |
| Melting Point | 129-130ºC |
| Molecular Formula | C23H24O6 |
| Molecular Weight | 396.433 |
| Flash Point | 201.8±23.6 °C |
| Exact Mass | 396.157288 |
| PSA | 74.22000 |
| LogP | 4.05 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.608 |
| InChIKey | ZMGUKFHHNQMKJI-UHFFFAOYSA-N |
| SMILES | COc1ccc(C=CC(=O)C=C(O)C=Cc2ccc(OC)c(OC)c2)cc1OC |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2914509090 |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| ASC-J9 |
| (1E,4Z,6E)-1,7-Bis(3,4-dimethoxyphenyl)-5-hydroxy-1,4,6-heptatrien-3-one |
| (1E,4Z,6E)-1,7-bis(3,4-dimethoxyphenyl)-5-hydroxyhepta-1,4,6-trien-3-one |
| 1,4,6-Heptatrien-3-one, 1,7-bis(3,4-dimethoxyphenyl)-5-hydroxy-, (1E,4Z,6E)- |
| Dimethylcurcumin |