4-Chloro-3-nitro-7-azaindole structure
|
Common Name | 4-Chloro-3-nitro-7-azaindole | ||
|---|---|---|---|---|
| CAS Number | 918519-53-6 | Molecular Weight | 197.579 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 395.6±37.0 °C at 760 mmHg | |
| Molecular Formula | C7H4ClN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.0±26.5 °C | |
| Name | 4-chloro-3-nitro-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 395.6±37.0 °C at 760 mmHg |
| Molecular Formula | C7H4ClN3O2 |
| Molecular Weight | 197.579 |
| Flash Point | 193.0±26.5 °C |
| Exact Mass | 196.999207 |
| PSA | 74.50000 |
| LogP | 2.29 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.742 |
| InChIKey | KCCXAUDAHDKANR-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1c[nH]c2nccc(Cl)c12 |
| Hazard Codes | T+ |
|---|---|
| HS Code | 2933990090 |
|
~93%
4-Chloro-3-nitr... CAS#:918519-53-6 |
| Literature: GENENTECH, INC.; HAN, Chong Patent: WO2013/163109 A1, 2013 ; Location in patent: Paragraph 00118 ; |
|
~%
4-Chloro-3-nitr... CAS#:918519-53-6 |
| Literature: WO2007/7919 A2, ; Page/Page column 43-44 ; WO 2007/007919 A2 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Chlor-3-nitro-1H-pyrrolo[2,3-b]pyridin |
| 1H-PYRROLO[2,3-B]PYRIDINE, 4-CHLORO-3-NITRO- |
| 1H-PYRROLO[2,3-B]PYRIDINE,4-CHLORO-3-NITRO- |
| 4-Chloro-3-nitro-7-azaindole |
| 1H-PYRROLO[2,3-B]PYRIDINE,4-CHLORO-3-NITRO |