3-Bromo-4,5,6-trimethoxy-2-methylphenol
Modify Date: 2025-08-26 04:09:21
3-Bromo-4,5,6-trimethoxy-2-methylphenol structure
|
Common Name | 3-Bromo-4,5,6-trimethoxy-2-methylphenol | ||
|---|---|---|---|---|
| CAS Number | 918799-14-1 | Molecular Weight | 277.112 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 345.3±37.0 °C at 760 mmHg | |
| Molecular Formula | C10H13BrO4 | Melting Point | 162.6ºC | |
| MSDS | N/A | Flash Point | 162.6±26.5 °C | |
| Name | 5-bromo-2,3,4-trimethoxy-6-methylphenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 345.3±37.0 °C at 760 mmHg |
| Melting Point | 162.6ºC |
| Molecular Formula | C10H13BrO4 |
| Molecular Weight | 277.112 |
| Flash Point | 162.6±26.5 °C |
| Exact Mass | 275.999725 |
| PSA | 47.92000 |
| LogP | 2.53 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.544 |
| InChIKey | UPFOLLAZMUMUCI-UHFFFAOYSA-N |
| SMILES | COc1c(O)c(C)c(Br)c(OC)c1OC |
| HS Code | 2909500000 |
|---|
|
~%
3-Bromo-4,5,6-t... CAS#:918799-14-1 |
| Literature: US2008/200732 A1, ; Page/Page column 16 ; |
| HS Code | 2909500000 |
|---|---|
| Summary | 2909500000 ether-phenols, ether-alcohol-phenols and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Phenol, 3-bromo-4,5,6-trimethoxy-2-methyl- |
| AC-4355 |
| 3-Bromo-4,5,6-trimethoxy-2-methylphenol |
| 2,3,4-trimethoxy-5-bromo-6-methylphenol |
| 3-Bromo-4,5,6-trimethoxy-2-methyl-phenol |