methyl 6-methylnaphthalene-1-carboxylate
methyl 6-methylnaphthalene-1-carboxylate structure
|
Common Name | methyl 6-methylnaphthalene-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 91902-60-2 | Molecular Weight | 200.23300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H12O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: Methyl 6-methylnaphthalene-1-carboxylate (Chinese name: 甲基萘-1-羧酸甲酯, CAS number: 91902-60-2, molecular formula: C13H12O2, molecular weight: 200.23300), For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl 6-methylnaphthalene-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H12O2 |
|---|---|
| Molecular Weight | 200.23300 |
| Exact Mass | 200.08400 |
| PSA | 26.30000 |
| LogP | 2.93480 |
| InChIKey | QKPWHTVLSINHGS-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cccc2cc(C)ccc12 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 6-methyl-[1]naphthoic acid methyl ester |
| methyl 6-methyl-1-naphthoate |
| 6-Methyl-naphthoesaeure-1-methylester |
| 6-methylnaphthalene-1-carboxylic acid methyl ester |
| 6-Methyl-[1]naphthoesaeure-methylester |
| 1-Naphthalenecarboxylic acid,6-methyl-,methyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 91902-60-2? |
| A: Chinese name of 91902-60-2 is 91902-60-2. |
| Q: What is the polar surface area (PSA) of methyl 6-methylnaphthalene-1-carboxylate? |
| A: Polar surface area (PSA) of methyl 6-methylnaphthalene-1-carboxylate is 26.30000. |
| Q: What is the SMILES notation of methyl 6-methylnaphthalene-1-carboxylate? |
| A: SMILES notation of methyl 6-methylnaphthalene-1-carboxylate is COC(=O)c1cccc2cc(C)ccc12. |
| Q: What is the English name of methyl 6-methylnaphthalene-1-carboxylate? |
| A: The English name of methyl 6-methylnaphthalene-1-carboxylate is methyl 6-methylnaphthalene-1-carboxylate. |
| Q: What is the LogP of methyl 6-methylnaphthalene-1-carboxylate? |
| A: LogP of methyl 6-methylnaphthalene-1-carboxylate is 2.93480. |
| Q: What is the CAS number of methyl 6-methylnaphthalene-1-carboxylate? |
| A: CAS number of methyl 6-methylnaphthalene-1-carboxylate is 91902-60-2. |
| Q: What is the molecular formula of methyl 6-methylnaphthalene-1-carboxylate? |
| A: Molecular formula of methyl 6-methylnaphthalene-1-carboxylate is C13H12O2. |
| Q: What English synonyms does methyl 6-methylnaphthalene-1-carboxylate have? |
| A: English synonyms of methyl 6-methylnaphthalene-1-carboxylate: 6-methyl-[1]naphthoic acid methyl ester, methyl 6-methyl-1-naphthoate, 6-Methyl-naphthoesaeure-1-methylester, 6-methylnaphthalene-1-carboxylic acid methyl ester, 6-Methyl-[1]naphthoesaeure-methylester, 1-Naphthalenecarboxylic acid,6-methyl-,methyl ester. |
| Q: What is the InChIKey of methyl 6-methylnaphthalene-1-carboxylate? |
| A: InChIKey of methyl 6-methylnaphthalene-1-carboxylate is QKPWHTVLSINHGS-UHFFFAOYSA-N. |
| Q: What is the molecular weight of methyl 6-methylnaphthalene-1-carboxylate? |
| A: Molecular weight of methyl 6-methylnaphthalene-1-carboxylate is 200.23300. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |