[1-(benzenesulfonyl)pyrrol-3-yl]-(4-methoxyphenyl)methanone structure
|
Common Name | [1-(benzenesulfonyl)pyrrol-3-yl]-(4-methoxyphenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 91917-45-2 | Molecular Weight | 341.38100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H15NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [1-(benzenesulfonyl)pyrrol-3-yl]-(4-methoxyphenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H15NO4S |
|---|---|
| Molecular Weight | 341.38100 |
| Exact Mass | 341.07200 |
| PSA | 73.75000 |
| LogP | 4.04550 |
| InChIKey | BMWYLRBRRIGKRM-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)c2ccn(S(=O)(=O)c3ccccc3)c2)cc1 |
|
~89%
[1-(benzenesulf... CAS#:91917-45-2 |
| Literature: Cadamuro, Silvano; Degani, Iacopo; Dughera, Stefano; Fochi, Rita; Gatti, Antonella; Piscopo, Laura Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1993 , # 2 p. 273 - 284 |
|
~%
[1-(benzenesulf... CAS#:91917-45-2 |
| Literature: Xu, Ru Xun; Anderson, Hugh J.; Gogan, Niall J.; Loader, Charles E.; McDonald, Robert Tetrahedron Letters, 1981 , vol. 22, # 49 p. 4899 - 4900 |
| 1H-Pyrrole,3-(4-methoxybenzoyl)-1-(phenylsulfonyl) |