naphthol as-mx
Modify Date: 2025-08-23 19:07:21
naphthol as-mx structure
|
Common Name | naphthol as-mx | ||
|---|---|---|---|---|
| CAS Number | 92-75-1 | Molecular Weight | 291.34400 | |
| Density | 1.248g/cm3 | Boiling Point | 412.5ºC at 760 mmHg | |
| Molecular Formula | C19H17NO2 | Melting Point | 226 °C | |
| MSDS | N/A | Flash Point | 203.2ºC | |
| Name | 3-Hydroxy-2',4'-dimethyl-2-naphthanilide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.248g/cm3 |
|---|---|
| Boiling Point | 412.5ºC at 760 mmHg |
| Melting Point | 226 °C |
| Molecular Formula | C19H17NO2 |
| Molecular Weight | 291.34400 |
| Flash Point | 203.2ºC |
| Exact Mass | 291.12600 |
| PSA | 49.33000 |
| LogP | 4.48750 |
| Index of Refraction | 1.699 |
| InChIKey | VTPSNRIENVXKCI-UHFFFAOYSA-N |
| SMILES | Cc1ccc(NC(=O)c2cc3ccccc3cc2O)c(C)c1 |
| WGK Germany | 3 |
|---|---|
| HS Code | 2924299090 |
|
~%
naphthol as-mx CAS#:92-75-1 |
| Literature: Analytical Chemistry, , vol. 66, # 8 p. 1347 - 1353 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Name: Fluorescence-based counterscreen assay for HCV NS3 helicase inhibitors of a ChemBridg...
Source: 1102
Target: N/A
External Id: 20130627FPNS3INTERFERECB
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: Fluorescence polarization based primary biochemical high throughput screening assay o...
Source: 1102
Target: NS3 [Hepatitis C virus]
External Id: 20130624FPNS3DACB
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
Total 4, Current Page 1 of 1
1
| MFCD00021633 |
| N-(2,4-dimethylphenyl)-3-hydroxynaphthalene-2-carboxamide |
| EINECS 202-186-0 |