2,3,5-trichloro-6-morpholin-4-ylcyclohexa-2,5-diene-1,4-dione structure
|
Common Name | 2,3,5-trichloro-6-morpholin-4-ylcyclohexa-2,5-diene-1,4-dione | ||
|---|---|---|---|---|
| CAS Number | 92013-92-8 | Molecular Weight | 296.53400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H8Cl3NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,3,5-trichloro-6-morpholin-4-ylcyclohexa-2,5-diene-1,4-dione |
|---|
| Molecular Formula | C10H8Cl3NO3 |
|---|---|
| Molecular Weight | 296.53400 |
| Exact Mass | 294.95700 |
| PSA | 46.61000 |
| LogP | 1.54790 |
| InChIKey | UEQMSOAUJRNFHG-UHFFFAOYSA-N |
| SMILES | O=C1C(Cl)=C(Cl)C(=O)C(N2CCOCC2)=C1Cl |
|
~%
2,3,5-trichloro... CAS#:92013-92-8 |
| Literature: Buckley et al. Journal of the Chemical Society, 1957 , p. 4880,4889 |