8-(ethoxymethyl)-9,9-dioxo-9$l^{6}-thia-8-azabicyclo[4.3.0]nona-1,3,5-trien-7-one structure
|
Common Name | 8-(ethoxymethyl)-9,9-dioxo-9$l^{6}-thia-8-azabicyclo[4.3.0]nona-1,3,5-trien-7-one | ||
|---|---|---|---|---|
| CAS Number | 92014-84-1 | Molecular Weight | 241.26400 | |
| Density | 1.393g/cm3 | Boiling Point | 395.7ºC at 760 mmHg | |
| Molecular Formula | C10H11NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.1ºC | |
| Name | 2-(ethoxymethyl)-1,1-dioxo-1,2-benzothiazol-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.393g/cm3 |
|---|---|
| Boiling Point | 395.7ºC at 760 mmHg |
| Molecular Formula | C10H11NO4S |
| Molecular Weight | 241.26400 |
| Flash Point | 193.1ºC |
| Exact Mass | 241.04100 |
| PSA | 72.06000 |
| LogP | 1.84380 |
| Index of Refraction | 1.582 |
| InChIKey | HQPGJZAUXRLWTA-UHFFFAOYSA-N |
| SMILES | CCOCN1C(=O)c2ccccc2S1(=O)=O |
|
~83%
8-(ethoxymethyl... CAS#:92014-84-1 |
| Literature: KUMIAI CHEMICAL INDUSTRY CO., LTD.; IHARA CHEMICAL INDUSTRY CO., LTD. Patent: EP1658771 A1, 2006 ; Location in patent: Page/Page column 27; 28 ; |
|
~%
8-(ethoxymethyl... CAS#:92014-84-1 |
| Literature: Pettit,G.R.; Settepani,J.A. Journal of Organic Chemistry, 1962 , vol. 27, p. 1714 - 1717 |
| 2-ethoxymethyl-1,2-benzisothiazoline-3-oxo-1,1-dioxide |
| N-Aethoxymethyl-saccharin |