Carbamic acid,[(4-chlorophenyl)methylene]bis-, diethyl ester (9CI) structure
|
Common Name | Carbamic acid,[(4-chlorophenyl)methylene]bis-, diethyl ester (9CI) | ||
|---|---|---|---|---|
| CAS Number | 92018-97-8 | Molecular Weight | 300.73800 | |
| Density | 1.242g/cm3 | Boiling Point | 470.2ºC at 760mmHg | |
| Molecular Formula | C13H17ClN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 238.2ºC | |
| Name | 4-Chlor-benzyliden-bis |
|---|---|
| Synonym | More Synonyms |
| Density | 1.242g/cm3 |
|---|---|
| Boiling Point | 470.2ºC at 760mmHg |
| Molecular Formula | C13H17ClN2O4 |
| Molecular Weight | 300.73800 |
| Flash Point | 238.2ºC |
| Exact Mass | 300.08800 |
| PSA | 76.66000 |
| LogP | 3.61260 |
| Index of Refraction | 1.528 |
| InChIKey | KOXULPDEJLSBRK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)NC(NC(=O)OCC)c1ccc(Cl)cc1 |
|
~%
Carbamic acid,[... CAS#:92018-97-8 |
| Literature: Oliverio; Sawicki Journal of Organic Chemistry, 1955 , vol. 20, p. 1733,1734 |
|
~%
Carbamic acid,[... CAS#:92018-97-8 |
| Literature: Merten,R.; Mueller,G. Angewandte Chemie, 1962 , vol. 74, p. 866 - 871 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| N,N'-(4-Chlor-benzyliden)-bis-carbamidsaeure-diaethylester |
| 1,2-di([1,1'-biphenyl]-4-yl)diazene oxide |
| Diazene,di(1,1'-biphenyl)-4-yl-,1-oxide |
| N,N'-(4-azoxy)-biphenyl |
| p-Azoxydiphenyl |
| [4.4'']Azoxybiphenyl |
| Di(1,1'-biphenyl)-4-yldiazene 1-oxide |
| 4-[(Z)-biphenyl-4-yl-NNO-azoxy]biphenyl |
| 4.4'-Diphenyl-azoxybenzol |
| OXIDO-(4-PHENYLPHENYL)-(4-PHENYLPHENYL)IMINO-AZANIUM |
| Bis-biphenyl-4-yl-diazen-N-oxid |
| Diazene,bis([1,1'-biphenyl]-4-yl)-,1-oxide (9CI) |
| N,N'-(4-chloro-benzylidene)-bis-carbamic acid diethyl ester |
| bis-biphenyl-4-yl-diazene-N-oxide |