ethyl 3,3,3-trichloro-2-(3,4-dimethylphenyl)propanoate structure
|
Common Name | ethyl 3,3,3-trichloro-2-(3,4-dimethylphenyl)propanoate | ||
|---|---|---|---|---|
| CAS Number | 92021-81-3 | Molecular Weight | 309.61600 | |
| Density | 1.275g/cm3 | Boiling Point | 366.6ºC at 760 mmHg | |
| Molecular Formula | C13H15Cl3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 135.9ºC | |
| Name | ethyl 3,3,3-trichloro-2-(3,4-dimethylphenyl)propanoate |
|---|
| Density | 1.275g/cm3 |
|---|---|
| Boiling Point | 366.6ºC at 760 mmHg |
| Molecular Formula | C13H15Cl3O2 |
| Molecular Weight | 309.61600 |
| Flash Point | 135.9ºC |
| Exact Mass | 308.01400 |
| PSA | 26.30000 |
| LogP | 4.32030 |
| Index of Refraction | 1.535 |
| InChIKey | ONIROLQWLUGNKE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(c1ccc(C)c(C)c1)C(Cl)(Cl)Cl |
|
~%
ethyl 3,3,3-tri... CAS#:92021-81-3 |
| Literature: Newman,M.S.; Eberwein,J.A. Journal of Organic Chemistry, 1964 , vol. 29, p. 2516 - 2519 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |