tert-Butyl (5-aminopyrazin-2-yl)carbamate structure
|
Common Name | tert-Butyl (5-aminopyrazin-2-yl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 920313-67-3 | Molecular Weight | 210.233 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 328.8±42.0 °C at 760 mmHg | |
| Molecular Formula | C9H14N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 152.7±27.9 °C | |
| Name | tert-Butyl (5-aminopyrazin-2-yl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 328.8±42.0 °C at 760 mmHg |
| Molecular Formula | C9H14N4O2 |
| Molecular Weight | 210.233 |
| Flash Point | 152.7±27.9 °C |
| Exact Mass | 210.111679 |
| PSA | 93.62000 |
| LogP | 1.20 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.592 |
| InChIKey | YOCMOBHWAUFCMT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)Nc1cnc(N)cn1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Carbamic acid, N-(5-amino-2-pyrazinyl)-, 1,1-dimethylethyl ester |
| tert-butyl N-(5-aminopyrazin-2-yl)carbamate |
| 2-Methyl-2-propanyl (5-amino-2-pyrazinyl)carbamate |