2-methyl-N-[(4-sulfamoylphenyl)methyl]prop-2-enamide structure
|
Common Name | 2-methyl-N-[(4-sulfamoylphenyl)methyl]prop-2-enamide | ||
|---|---|---|---|---|
| CAS Number | 92093-09-9 | Molecular Weight | 254.30500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H14N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-methyl-N-[(4-sulfamoylphenyl)methyl]prop-2-enamide |
|---|
| Molecular Formula | C11H14N2O3S |
|---|---|
| Molecular Weight | 254.30500 |
| Exact Mass | 254.07300 |
| PSA | 101.13000 |
| LogP | 3.14770 |
| InChIKey | XJXNMVPQBGSXCB-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)NCc1ccc(S(N)(=O)=O)cc1 |
|
~73%
2-methyl-N-[(4-... CAS#:92093-09-9 |
| Literature: Gorchakova; Budzan; Andronova; Kolokolov; Virnik Journal of applied chemistry of the USSR, 1984 , vol. 57, # 5 pt 2 p. 1038 - 1041 |