Capecitabine-2',3'-cyclic Carbonate structure
|
Common Name | Capecitabine-2',3'-cyclic Carbonate | ||
|---|---|---|---|---|
| CAS Number | 921769-65-5 | Molecular Weight | 385.34 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H20FN3O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Capecitabine-2',3'-cyclic CarbonateCapecitabine-2',3'-cyclic carbonate (Compd 5a) is a 5'-deoxy-5-fluorocytidine derivative with anticancer activity[1]. |
| Name | pentyl N-[1-[(3aS,4R,6R)-6-methyl-2-oxo-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-5-fluoro-2-oxopyrimidin-4-yl]carbamate |
|---|---|
| Synonym | More Synonyms |
| Description | Capecitabine-2',3'-cyclic carbonate (Compd 5a) is a 5'-deoxy-5-fluorocytidine derivative with anticancer activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C16H20FN3O7 |
|---|---|
| Molecular Weight | 385.34 |
| Exact Mass | 385.12900 |
| PSA | 121.47000 |
| LogP | 1.95600 |
| InChIKey | VTAMAYSBXXKQPB-IZSYJUOESA-N |
| SMILES | CCCCCOC(=O)Nc1nc(=O)n(C2OC(C)C3OC(=O)OC32)cc1F |
| Storage condition | -20℃ |
| RIDADR | NONH for all modes of transport |
|---|
| Capecitabine-2',3'-cyclic Carbonate |
| Capecitabine Impurity 8 |